C25H29N5O4S — CID 70271487
1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopentyl]pyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea (PubChem CID 70271487) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopentyl]pyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopentyl]pyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 70271487 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopentyl]pyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea |
| SMILES | Nc1cc(C2(S(=O)(=O)c3ccccc3)CCCC2)nc(-c2ccc(NC(=O)NCCCO)cc2)n1 |
| InChI | InChI=1S/C25H29N5O4S/c26-22-17-21(25(13-4-5-14-25)35(33,34)20-7-2-1-3-8-20)29-23(30-22)18-9-11-19(12-10-18)28-24(32)27-15-6-16-31/h1-3,7-12,17,31H,4-6,13-16H2,(H2,26,29,30)(H2,27,28,32) |
| InChIKey | JRBRMVSMLFQGFI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|