C18H24N6O3S — CID 70276343
1-(2-aminoethyl)-3-[4-[4-amino-6-(1-ethylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]urea (PubChem CID 70276343) has the molecular formula C18H24N6O3S and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-[4-[4-amino-6-(1-ethylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]urea.
| Compound Name | 1-(2-aminoethyl)-3-[4-[4-amino-6-(1-ethylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 70276343 |
| Molecular Formula | C18H24N6O3S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-(2-aminoethyl)-3-[4-[4-amino-6-(1-ethylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]urea |
| SMILES | CCS(=O)(=O)C1(c2cc(N)nc(-c3ccc(NC(=O)NCCN)cc3)n2)CC1 |
| InChI | InChI=1S/C18H24N6O3S/c1-2-28(26,27)18(7-8-18)14-11-15(20)24-16(23-14)12-3-5-13(6-4-12)22-17(25)21-10-9-19/h3-6,11H,2,7-10,19H2,1H3,(H2,20,23,24)(H2,21,22,25) |
| InChIKey | HKRWYDBGOLAMHC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |