C18H25N5O3S — CID 70305431
1-[4-[4-amino-6-(2-methylsulfonylpropan-2-yl)pyrimidin-2-yl]phenyl]-3-propan-2-ylurea (PubChem CID 70305431) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-[4-[4-amino-6-(2-methylsulfonylpropan-2-yl)pyrimidin-2-yl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[4-amino-6-(2-methylsulfonylpropan-2-yl)pyrimidin-2-yl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 70305431 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[4-[4-amino-6-(2-methylsulfonylpropan-2-yl)pyrimidin-2-yl]phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc(-c2nc(N)cc(C(C)(C)S(C)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C18H25N5O3S/c1-11(2)20-17(24)21-13-8-6-12(7-9-13)16-22-14(10-15(19)23-16)18(3,4)27(5,25)26/h6-11H,1-5H3,(H2,19,22,23)(H2,20,21,24) |
| InChIKey | ADWYHQLBHKXEKE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |