C23H22ClFN4OS — CID 143741649
4-[4-[1-(3-chloro-4-fluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline (PubChem CID 143741649) has the molecular formula C23H22ClFN4OS and a molecular weight of 456.97 g/mol. Its IUPAC name is 4-[4-[1-(3-chloro-4-fluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline.
| Compound Name | 4-[4-[1-(3-chloro-4-fluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143741649 |
| Molecular Formula | C23H22ClFN4OS |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 4-[4-[1-(3-chloro-4-fluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)cc(C3(Sc4ccc(F)c(Cl)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H22ClFN4OS/c24-18-13-17(5-6-19(18)25)31-23(7-8-23)20-14-21(29-9-11-30-12-10-29)28-22(27-20)15-1-3-16(26)4-2-15/h1-6,13-14H,7-12,26H2 |
| InChIKey | OJHFDQGVGNSAHN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|