C23H22F2N4OS — CID 143741509
4-[4-[1-(2,4-difluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline (PubChem CID 143741509) has the molecular formula C23H22F2N4OS and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-[4-[1-(2,4-difluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline.
| Compound Name | 4-[4-[1-(2,4-difluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143741509 |
| Molecular Formula | C23H22F2N4OS |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 4-[4-[1-(2,4-difluorophenyl)sulfanylcyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)cc(C3(Sc4ccc(F)cc4F)CC3)n2)cc1 |
| InChI | InChI=1S/C23H22F2N4OS/c24-16-3-6-19(18(25)13-16)31-23(7-8-23)20-14-21(29-9-11-30-12-10-29)28-22(27-20)15-1-4-17(26)5-2-15/h1-6,13-14H,7-12,26H2 |
| InChIKey | UBSCOGVZRGOXJV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|