C23H37N5O2S — CID 143633131
ethanamine;formaldehyde;4-[4-morpholin-4-yl-6-(2-propan-2-ylsulfanylpropan-2-yl)pyrimidin-2-yl]aniline (PubChem CID 143633131) has the molecular formula C23H37N5O2S and a molecular weight of 447.65 g/mol. Its IUPAC name is ethanamine;formaldehyde;4-[4-morpholin-4-yl-6-(2-propan-2-ylsulfanylpropan-2-yl)pyrimidin-2-yl]aniline.
| Compound Name | ethanamine;formaldehyde;4-[4-morpholin-4-yl-6-(2-propan-2-ylsulfanylpropan-2-yl)pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143633131 |
| Molecular Formula | C23H37N5O2S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | ethanamine;formaldehyde;4-[4-morpholin-4-yl-6-(2-propan-2-ylsulfanylpropan-2-yl)pyrimidin-2-yl]aniline |
| SMILES | C=O.CC(C)SC(C)(C)c1cc(N2CCOCC2)nc(-c2ccc(N)cc2)n1.CCN |
| InChI | InChI=1S/C20H28N4OS.C2H7N.CH2O/c1-14(2)26-20(3,4)17-13-18(24-9-11-25-12-10-24)23-19(22-17)15-5-7-16(21)8-6-15;1-2-3;1-2/h5-8,13-14H,9-12,21H2,1-4H3;2-3H2,1H3;1H2 |
| InChIKey | GPXASEHPMPLCRW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|