C26H31FN4OS — CID 143633035
N-butyl-4-[4-[2-(4-fluorophenyl)sulfanylpropan-2-yl]-6-(1,3-oxazolidin-3-yl)pyrimidin-2-yl]aniline (PubChem CID 143633035) has the molecular formula C26H31FN4OS and a molecular weight of 466.63 g/mol. Its IUPAC name is N-butyl-4-[4-[2-(4-fluorophenyl)sulfanylpropan-2-yl]-6-(1,3-oxazolidin-3-yl)pyrimidin-2-yl]aniline.
| Compound Name | N-butyl-4-[4-[2-(4-fluorophenyl)sulfanylpropan-2-yl]-6-(1,3-oxazolidin-3-yl)pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143633035 |
| Molecular Formula | C26H31FN4OS |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-butyl-4-[4-[2-(4-fluorophenyl)sulfanylpropan-2-yl]-6-(1,3-oxazolidin-3-yl)pyrimidin-2-yl]aniline |
| SMILES | CCCCNc1ccc(-c2nc(N3CCOC3)cc(C(C)(C)Sc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C26H31FN4OS/c1-4-5-14-28-21-10-6-19(7-11-21)25-29-23(17-24(30-25)31-15-16-32-18-31)26(2,3)33-22-12-8-20(27)9-13-22/h6-13,17,28H,4-5,14-16,18H2,1-3H3 |
| InChIKey | DQAJFOVHELKGMP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|