C24H35N7O4 — CID 142730894
7-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)anilino]-N-hydroxyheptanamide (PubChem CID 142730894) has the molecular formula C24H35N7O4 and a molecular weight of 485.59 g/mol. Its IUPAC name is 7-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)anilino]-N-hydroxyheptanamide.
| Compound Name | 7-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)anilino]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 142730894 |
| Molecular Formula | C24H35N7O4 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 7-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)anilino]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCNc1ccc(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1)NO |
| InChI | InChI=1S/C24H35N7O4/c32-21(29-33)5-3-1-2-4-10-25-20-8-6-19(7-9-20)22-26-23(30-11-15-34-16-12-30)28-24(27-22)31-13-17-35-18-14-31/h6-9,25,33H,1-5,10-18H2,(H,29,32) |
| InChIKey | FXKKZKFUGVMVBR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|