C20H29N9O5 — CID 142730895
1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[5-(hydroxyamino)-5-oxopentyl]imidazole-4-carboxamide (PubChem CID 142730895) has the molecular formula C20H29N9O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is 1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[5-(hydroxyamino)-5-oxopentyl]imidazole-4-carboxamide.
| Compound Name | 1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[5-(hydroxyamino)-5-oxopentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 142730895 |
| Molecular Formula | C20H29N9O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[5-(hydroxyamino)-5-oxopentyl]imidazole-4-carboxamide |
| SMILES | O=C(CCCCNC(=O)c1cn(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cn1)NO |
| InChI | InChI=1S/C20H29N9O5/c30-16(26-32)3-1-2-4-21-17(31)15-13-29(14-22-15)20-24-18(27-5-9-33-10-6-27)23-19(25-20)28-7-11-34-12-8-28/h13-14,32H,1-12H2,(H,21,31)(H,26,30) |
| InChIKey | IMGLZQCWWWKNIS-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 159.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|