C22H30F3N9O3 — CID 171478100
5-[4-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-N-hydroxypentanamide (PubChem CID 171478100) has the molecular formula C22H30F3N9O3 and a molecular weight of 525.54 g/mol. Its IUPAC name is 5-[4-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-N-hydroxypentanamide.
| Compound Name | 5-[4-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 171478100 |
| Molecular Formula | C22H30F3N9O3 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 5-[4-[4-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]piperazin-1-yl]-N-hydroxypentanamide |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)nc(N3CCN(CCCCC(=O)NO)CC3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H30F3N9O3/c23-22(24,25)16-13-15(14-27-18(16)26)19-28-20(30-21(29-19)34-9-11-37-12-10-34)33-7-5-32(6-8-33)4-2-1-3-17(35)31-36/h13-14,36H,1-12H2,(H2,26,27)(H,31,35) |
| InChIKey | PRZOQTUQAJKZMR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|