C29H39FN8O6S — CID 171740316
5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-hydroxypentanamide (PubChem CID 171740316) has the molecular formula C29H39FN8O6S and a molecular weight of 646.75 g/mol. Its IUPAC name is 5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-hydroxypentanamide.
| Compound Name | 5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 171740316 |
| Molecular Formula | C29H39FN8O6S |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | 5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-hydroxypentanamide |
| SMILES | COc1ncc(-c2nc(N3CCOCC3)nc3c(CN4CCN(CCCCC(=O)NO)CC4)cc(F)cc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C29H39FN8O6S/c1-43-28-24(35-45(2,41)42)16-20(18-31-28)26-23-17-22(30)15-21(27(23)33-29(32-26)38-11-13-44-14-12-38)19-37-9-7-36(8-10-37)6-4-3-5-25(39)34-40/h15-18,35,40H,3-14,19H2,1-2H3,(H,34,39) |
| InChIKey | IBZWAEBPSPAQOB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|