C31H40FN7O7S — CID 171740273
1-[4-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxycyclohexyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 171740273) has the molecular formula C31H40FN7O7S and a molecular weight of 673.77 g/mol. Its IUPAC name is 1-[4-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxycyclohexyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[4-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxycyclohexyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 171740273 |
| Molecular Formula | C31H40FN7O7S |
| Molecular Weight | 673.77 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | 1-[4-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxycyclohexyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ncc(-c2nc(N3CCOCC3)nc3c(OC4CCC(N5CCC(C(=O)NO)CC5)CC4)cc(F)cc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C31H40FN7O7S/c1-44-30-25(37-47(2,42)43)15-20(18-33-30)27-24-16-21(32)17-26(28(24)35-31(34-27)39-11-13-45-14-12-39)46-23-5-3-22(4-6-23)38-9-7-19(8-10-38)29(40)36-41/h15-19,22-23,37,41H,3-14H2,1-2H3,(H,36,40) |
| InChIKey | XFFLJYVOMSLOBF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 168.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|