C26H33FN6O7S — CID 171740306
7-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxy-N-hydroxyheptanamide (PubChem CID 171740306) has the molecular formula C26H33FN6O7S and a molecular weight of 592.65 g/mol. Its IUPAC name is 7-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxy-N-hydroxyheptanamide.
| Compound Name | 7-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxy-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 171740306 |
| Molecular Formula | C26H33FN6O7S |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 7-[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]oxy-N-hydroxyheptanamide |
| SMILES | COc1ncc(-c2nc(N3CCOCC3)nc3c(OCCCCCCC(=O)NO)cc(F)cc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C26H33FN6O7S/c1-38-25-20(32-41(2,36)37)13-17(16-28-25)23-19-14-18(27)15-21(40-10-6-4-3-5-7-22(34)31-35)24(19)30-26(29-23)33-8-11-39-12-9-33/h13-16,32,35H,3-12H2,1-2H3,(H,31,34) |
| InChIKey | VTTIHTFKLCKESL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|