C28H37FN8O6S — CID 171740196
1-[2-[1-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperidin-4-yl]ethyl]-3-hydroxyurea (PubChem CID 171740196) has the molecular formula C28H37FN8O6S and a molecular weight of 632.72 g/mol. Its IUPAC name is 1-[2-[1-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperidin-4-yl]ethyl]-3-hydroxyurea.
| Compound Name | 1-[2-[1-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperidin-4-yl]ethyl]-3-hydroxyurea |
|---|---|
| PubChem CID | 171740196 |
| Molecular Formula | C28H37FN8O6S |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 1-[2-[1-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperidin-4-yl]ethyl]-3-hydroxyurea |
| SMILES | COc1ncc(-c2nc(N3CCOCC3)nc3c(CN4CCC(CCNC(=O)NO)CC4)cc(F)cc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C28H37FN8O6S/c1-42-26-23(35-44(2,40)41)14-19(16-31-26)24-22-15-21(29)13-20(25(22)33-27(32-24)37-9-11-43-12-10-37)17-36-7-4-18(5-8-36)3-6-30-28(38)34-39/h13-16,18,35,39H,3-12,17H2,1-2H3,(H2,30,34,38) |
| InChIKey | NVINRXSXJZRIDR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 171.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|