C34H47FN8O7S — CID 171740223
5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-(oxan-2-yloxy)pentanamide (PubChem CID 171740223) has the molecular formula C34H47FN8O7S and a molecular weight of 730.86 g/mol. Its IUPAC name is 5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-(oxan-2-yloxy)pentanamide.
| Compound Name | 5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-(oxan-2-yloxy)pentanamide |
|---|---|
| PubChem CID | 171740223 |
| Molecular Formula | C34H47FN8O7S |
| Molecular Weight | 730.86 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | 5-[4-[[6-fluoro-4-[5-(methanesulfonamido)-6-methoxy-3-pyridinyl]-2-morpholin-4-ylquinazolin-8-yl]methyl]piperazin-1-yl]-N-(oxan-2-yloxy)pentanamide |
| SMILES | COc1ncc(-c2nc(N3CCOCC3)nc3c(CN4CCN(CCCCC(=O)NOC5CCCCO5)CC4)cc(F)cc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C34H47FN8O7S/c1-47-33-28(40-51(2,45)46)20-24(22-36-33)31-27-21-26(35)19-25(32(27)38-34(37-31)43-14-17-48-18-15-43)23-42-12-10-41(11-13-42)9-5-3-7-29(44)39-50-30-8-4-6-16-49-30/h19-22,30,40H,3-18,23H2,1-2H3,(H,39,44) |
| InChIKey | PMRODXKDIRDWBF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|