C25H35N7O3 — CID 118374649
N-hydroxy-6-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methylamino]hexanamide (PubChem CID 118374649) has the molecular formula C25H35N7O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-hydroxy-6-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methylamino]hexanamide.
| Compound Name | N-hydroxy-6-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methylamino]hexanamide |
|---|---|
| PubChem CID | 118374649 |
| Molecular Formula | C25H35N7O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | N-hydroxy-6-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methylamino]hexanamide |
| SMILES | CC(C)n1cnc2c(-c3cccc(CNCCCCCC(=O)NO)c3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C25H35N7O3/c1-18(2)32-17-27-23-22(28-25(29-24(23)32)31-11-13-35-14-12-31)20-8-6-7-19(15-20)16-26-10-5-3-4-9-21(33)30-34/h6-8,15,17-18,26,34H,3-5,9-14,16H2,1-2H3,(H,30,33) |
| InChIKey | XHYXECBPBSOUIX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|