C26H35N5O4 — CID 160607967
1-hydroxy-7-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]heptan-2-one (PubChem CID 160607967) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is 1-hydroxy-7-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]heptan-2-one.
| Compound Name | 1-hydroxy-7-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]heptan-2-one |
|---|---|
| PubChem CID | 160607967 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 1-hydroxy-7-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]heptan-2-one |
| SMILES | CC(C)n1cnc2c(-c3cccc(COCCCCCC(=O)CO)c3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C26H35N5O4/c1-19(2)31-18-27-24-23(28-26(29-25(24)31)30-10-13-34-14-11-30)21-8-6-7-20(15-21)17-35-12-5-3-4-9-22(33)16-32/h6-8,15,18-19,32H,3-5,9-14,16-17H2,1-2H3 |
| InChIKey | RFDAXHFLXOTOLS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|