C25H31N5O4 — CID 157266940
1-hydroxy-7-[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]heptane-2,6-dione (PubChem CID 157266940) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-hydroxy-7-[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]heptane-2,6-dione.
| Compound Name | 1-hydroxy-7-[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]heptane-2,6-dione |
|---|---|
| PubChem CID | 157266940 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-hydroxy-7-[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]heptane-2,6-dione |
| SMILES | CC(C)n1cnc2c(-c3cccc(CC(=O)CCCC(=O)CO)c3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C25H31N5O4/c1-17(2)30-16-26-23-22(27-25(28-24(23)30)29-9-11-34-12-10-29)19-6-3-5-18(13-19)14-20(32)7-4-8-21(33)15-31/h3,5-6,13,16-17,31H,4,7-12,14-15H2,1-2H3 |
| InChIKey | AYCHBLQDDOBUQA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |