C24H32N6O4 — CID 118366949
N-hydroxy-5-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]pentanamide (PubChem CID 118366949) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-hydroxy-5-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]pentanamide.
| Compound Name | N-hydroxy-5-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]pentanamide |
|---|---|
| PubChem CID | 118366949 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-hydroxy-5-[[3-(2-morpholin-4-yl-9-propan-2-ylpurin-6-yl)phenyl]methoxy]pentanamide |
| SMILES | CC(C)n1cnc2c(-c3cccc(COCCCCC(=O)NO)c3)nc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C24H32N6O4/c1-17(2)30-16-25-22-21(26-24(27-23(22)30)29-9-12-33-13-10-29)19-7-5-6-18(14-19)15-34-11-4-3-8-20(31)28-32/h5-7,14,16-17,32H,3-4,8-13,15H2,1-2H3,(H,28,31) |
| InChIKey | SOYLEDMZIHRFDM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|