C20H35N7O3 — CID 5297351
N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N'-methyloctanehydrazide (PubChem CID 5297351) has the molecular formula C20H35N7O3 and a molecular weight of 421.55 g/mol. Its IUPAC name is N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N'-methyloctanehydrazide.
| Compound Name | N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N'-methyloctanehydrazide |
|---|---|
| PubChem CID | 5297351 |
| Molecular Formula | C20H35N7O3 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N'-methyloctanehydrazide |
| SMILES | CCCCCCCC(=O)NN(C)c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H35N7O3/c1-3-4-5-6-7-8-17(28)24-25(2)18-21-19(26-9-13-29-14-10-26)23-20(22-18)27-11-15-30-16-12-27/h3-16H2,1-2H3,(H,24,28) |
| InChIKey | GLVUPSRIBDSRAN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|