C18H32N8O4 — CID 87263949
N-[(2S)-2-[[[4-(ethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87263949) has the molecular formula C18H32N8O4 and a molecular weight of 424.51 g/mol. Its IUPAC name is N-[(2S)-2-[[[4-(ethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-2-[[[4-(ethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87263949 |
| Molecular Formula | C18H32N8O4 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[(2S)-2-[[[4-(ethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@@H](CN(O)C=O)C(=O)NNc1nc(NCC)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H32N8O4/c1-3-5-6-7-14(12-26(29)13-27)15(28)23-24-17-20-16(19-4-2)21-18(22-17)25-8-10-30-11-9-25/h13-14,29H,3-12H2,1-2H3,(H,23,28)(H2,19,20,21,22,24)/t14-/m0/s1 |
| InChIKey | IWMOLXOJOXIQCO-AWEZNQCLSA-N |
| XLogP | 0.63 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|