C22H30F3N9O3 — CID 87263925
N-hydroxy-N-[2-[[[5-(4-pyrimidin-2-ylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide (PubChem CID 87263925) has the molecular formula C22H30F3N9O3 and a molecular weight of 525.54 g/mol. Its IUPAC name is N-hydroxy-N-[2-[[[5-(4-pyrimidin-2-ylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[2-[[[5-(4-pyrimidin-2-ylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 87263925 |
| Molecular Formula | C22H30F3N9O3 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | N-hydroxy-N-[2-[[[5-(4-pyrimidin-2-ylpiperazin-1-yl)-4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1ncc(N2CCN(c3ncccn3)CC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H30F3N9O3/c1-2-3-4-6-16(14-34(37)15-35)19(36)30-31-20-28-13-17(18(29-20)22(23,24)25)32-9-11-33(12-10-32)21-26-7-5-8-27-21/h5,7-8,13,15-16,37H,2-4,6,9-12,14H2,1H3,(H,30,36)(H,28,29,31) |
| InChIKey | GOMOUOSSSKLUKE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 139.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|