C20H35N7O3 — CID 87264253
N-[(2S)-2-[[[4-(4-ethylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264253) has the molecular formula C20H35N7O3 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[(2S)-2-[[[4-(4-ethylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2S)-2-[[[4-(4-ethylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264253 |
| Molecular Formula | C20H35N7O3 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-[(2S)-2-[[[4-(4-ethylpiperazin-1-yl)-6-methylpyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@@H](CN(O)C=O)C(=O)NNc1nc(C)cc(N2CCN(CC)CC2)n1 |
| InChI | InChI=1S/C20H35N7O3/c1-4-6-7-8-17(14-27(30)15-28)19(29)23-24-20-21-16(3)13-18(22-20)26-11-9-25(5-2)10-12-26/h13,15,17,30H,4-12,14H2,1-3H3,(H,23,29)(H,21,22,24)/t17-/m0/s1 |
| InChIKey | TWNDVBDJQWWKIW-KRWDZBQOSA-N |
| XLogP | 1.41 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|