C17H23N5O4 — CID 87264425
N-[(2R)-2-[[[4-(furan-3-yl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264425) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[(2R)-2-[[[4-(furan-3-yl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[[4-(furan-3-yl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264425 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(2R)-2-[[[4-(furan-3-yl)pyrimidin-2-yl]amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1nccc(-c2ccoc2)n1 |
| InChI | InChI=1S/C17H23N5O4/c1-2-3-4-5-13(10-22(25)12-23)16(24)20-21-17-18-8-6-15(19-17)14-7-9-26-11-14/h6-9,11-13,25H,2-5,10H2,1H3,(H,20,24)(H,18,19,21)/t13-/m1/s1 |
| InChIKey | ATOGACDVWRWBEV-CYBMUJFWSA-N |
| XLogP | 2.22 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|