C13H21N3O4 — CID 142776027
N-[(2R)-2-[(furan-3-ylamino)carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 142776027) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[(2R)-2-[(furan-3-ylamino)carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[(furan-3-ylamino)carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 142776027 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-[(2R)-2-[(furan-3-ylamino)carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1ccoc1 |
| InChI | InChI=1S/C13H21N3O4/c1-2-3-4-5-11(8-16(19)10-17)13(18)15-14-12-6-7-20-9-12/h6-7,9-11,14,19H,2-5,8H2,1H3,(H,15,18)/t11-/m1/s1 |
| InChIKey | KLIBUBQBFPHBQH-LLVKDONJSA-N |
| XLogP | 1.77 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|