C16H22Cl2N4O4 — CID 10111888
N-[2-[[(3,4-dichlorophenyl)carbamoylamino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 10111888) has the molecular formula C16H22Cl2N4O4 and a molecular weight of 405.28 g/mol. Its IUPAC name is N-[2-[[(3,4-dichlorophenyl)carbamoylamino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[2-[[(3,4-dichlorophenyl)carbamoylamino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 10111888 |
| Molecular Formula | C16H22Cl2N4O4 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[2-[[(3,4-dichlorophenyl)carbamoylamino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N4O4/c1-2-3-4-5-11(9-22(26)10-23)15(24)20-21-16(25)19-12-6-7-13(17)14(18)8-12/h6-8,10-11,26H,2-5,9H2,1H3,(H,20,24)(H2,19,21,25) |
| InChIKey | MNAXDSNYGVLYBJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|