C21H25N5O4 — CID 87928335
N-hydroxy-N-[(2R)-2-[(9H-pyrido[3,4-b]indole-3-carbonylamino)carbamoyl]heptyl]formamide (PubChem CID 87928335) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-hydroxy-N-[(2R)-2-[(9H-pyrido[3,4-b]indole-3-carbonylamino)carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[(2R)-2-[(9H-pyrido[3,4-b]indole-3-carbonylamino)carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 87928335 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-hydroxy-N-[(2R)-2-[(9H-pyrido[3,4-b]indole-3-carbonylamino)carbamoyl]heptyl]formamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C21H25N5O4/c1-2-3-4-7-14(12-26(30)13-27)20(28)24-25-21(29)18-10-16-15-8-5-6-9-17(15)23-19(16)11-22-18/h5-6,8-11,13-14,23,30H,2-4,7,12H2,1H3,(H,24,28)(H,25,29)/t14-/m1/s1 |
| InChIKey | NHLMNGCQMBZGSC-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|