C12H25N3O5 — CID 87264686
N-[2-[(2,3-dihydroxypropylamino)carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 87264686) has the molecular formula C12H25N3O5 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[2-[(2,3-dihydroxypropylamino)carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[2-[(2,3-dihydroxypropylamino)carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264686 |
| Molecular Formula | C12H25N3O5 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-[2-[(2,3-dihydroxypropylamino)carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNCC(O)CO |
| InChI | InChI=1S/C12H25N3O5/c1-2-3-4-5-10(7-15(20)9-17)12(19)14-13-6-11(18)8-16/h9-11,13,16,18,20H,2-8H2,1H3,(H,14,19) |
| InChIKey | IHJGQOHZRATENT-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|