C17H33N3O4 — CID 59902226
N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]heptanamide (PubChem CID 59902226) has the molecular formula C17H33N3O4 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]heptanamide.
| Compound Name | N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]heptanamide |
|---|---|
| PubChem CID | 59902226 |
| Molecular Formula | C17H33N3O4 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | N-[(2S)-1-(dimethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]heptanamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)N[C@H](C(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H33N3O4/c1-7-8-9-10-13(11-20(24)12-21)15(22)18-14(17(2,3)4)16(23)19(5)6/h12-14,24H,7-11H2,1-6H3,(H,18,22)/t13?,14-/m1/s1 |
| InChIKey | VCJSQPUBQACCSW-ARLHGKGLSA-N |
| XLogP | 1.65 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|