C19H35N3O4 — CID 122408081
(2S)-N-[(2S)-3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide (PubChem CID 122408081) has the molecular formula C19H35N3O4 and a molecular weight of 369.51 g/mol. Its IUPAC name is (2S)-N-[(2S)-3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide.
| Compound Name | (2S)-N-[(2S)-3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 122408081 |
| Molecular Formula | C19H35N3O4 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | (2S)-N-[(2S)-3,3-dimethyl-1-oxo-1-piperidin-1-ylbutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide |
| SMILES | CCCC[C@@H](CN(O)C=O)C(=O)N[C@H](C(=O)N1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C19H35N3O4/c1-5-6-10-15(13-22(26)14-23)17(24)20-16(19(2,3)4)18(25)21-11-8-7-9-12-21/h14-16,26H,5-13H2,1-4H3,(H,20,24)/t15-,16+/m0/s1 |
| InChIKey | LUUWHMFSUQYFLW-JKSUJKDBSA-N |
| XLogP | 2.18 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|