C29H40F4N4O4 — CID 74220896
(2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-(4,5,6,7-tetrafluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]butan-2-yl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 74220896) has the molecular formula C29H40F4N4O4 and a molecular weight of 584.66 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-(4,5,6,7-tetrafluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]butan-2-yl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-(4,5,6,7-tetrafluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]butan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 74220896 |
| Molecular Formula | C29H40F4N4O4 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-(4,5,6,7-tetrafluoro-1,3-dihydroisoindol-2-yl)piperidin-1-yl]butan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCC(N2Cc3c(F)c(F)c(F)c(F)c3C2)CC1 |
| InChI | InChI=1S/C29H40F4N4O4/c1-29(2,3)26(34-27(39)18(13-37(41)16-38)12-17-6-4-5-7-17)28(40)35-10-8-19(9-11-35)36-14-20-21(15-36)23(31)25(33)24(32)22(20)30/h16-19,26,41H,4-15H2,1-3H3,(H,34,39)/t18-,26-/m1/s1 |
| InChIKey | XISNYZPFANBDTD-WXTAPIANSA-N |
| XLogP | 4.12 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|