C31H45N5O4 — CID 74221349
(2R)-N-[(2S)-1-[4-(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide (PubChem CID 74221349) has the molecular formula C31H45N5O4 and a molecular weight of 551.73 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[4-(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-N-[(2S)-1-[4-(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 74221349 |
| Molecular Formula | C31H45N5O4 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | (2R)-N-[(2S)-1-[4-(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCC(N2CCc3cc(C#N)ccc3C2)CC1 |
| InChI | InChI=1S/C31H45N5O4/c1-31(2,3)28(33-29(38)26(20-36(40)21-37)16-22-6-4-5-7-22)30(39)34-14-11-27(12-15-34)35-13-10-24-17-23(18-32)8-9-25(24)19-35/h8-9,17,21-22,26-28,40H,4-7,10-16,19-20H2,1-3H3,(H,33,38)/t26-,28-/m1/s1 |
| InChIKey | NCNVGPLCWFMCPW-IXCJQBJRSA-N |
| XLogP | 3.48 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|