C29H44N4O6 — CID 59979614
4-[1-[2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N-methylbenzamide (PubChem CID 59979614) has the molecular formula C29H44N4O6 and a molecular weight of 544.69 g/mol. Its IUPAC name is 4-[1-[2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N-methylbenzamide.
| Compound Name | 4-[1-[2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N-methylbenzamide |
|---|---|
| PubChem CID | 59979614 |
| Molecular Formula | C29H44N4O6 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 4-[1-[2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(OC2CCN(C(=O)C(NC(=O)[C@H](CC3CCCC3)CN(O)C=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H44N4O6/c1-29(2,3)25(31-27(36)22(18-33(38)19-34)17-20-7-5-6-8-20)28(37)32-15-13-24(14-16-32)39-23-11-9-21(10-12-23)26(35)30-4/h9-12,19-20,22,24-25,38H,5-8,13-18H2,1-4H3,(H,30,35)(H,31,36)/t22-,25?/m1/s1 |
| InChIKey | BXWGWEGMWGRXPM-UFUCKMQHSA-N |
| XLogP | 2.99 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|