C30H46N4O6 — CID 58628941
(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-(4-methoxybenzoyl)piperidin-4-yl]-N,3,3-trimethylbutanamide (PubChem CID 58628941) has the molecular formula C30H46N4O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-(4-methoxybenzoyl)piperidin-4-yl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-(4-methoxybenzoyl)piperidin-4-yl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58628941 |
| Molecular Formula | C30H46N4O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-(4-methoxybenzoyl)piperidin-4-yl]-N,3,3-trimethylbutanamide |
| SMILES | COc1ccc(C(=O)N2CCC(N(C)C(=O)[C@@H](NC(=O)[C@H](CC3CCCC3)CN(O)C=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C30H46N4O6/c1-30(2,3)26(31-27(36)23(19-34(39)20-35)18-21-8-6-7-9-21)29(38)32(4)24-14-16-33(17-15-24)28(37)22-10-12-25(40-5)13-11-22/h10-13,20-21,23-24,26,39H,6-9,14-19H2,1-5H3,(H,31,36)/t23-,26-/m1/s1 |
| InChIKey | UJYGLDMHSUEUED-ZEQKJWHPSA-N |
| XLogP | 3.33 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|