C31H44N6O5S — CID 58628960
(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]butanamide (PubChem CID 58628960) has the molecular formula C31H44N6O5S and a molecular weight of 612.80 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 58628960 |
| Molecular Formula | C31H44N6O5S |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(2-pyridin-4-yl-1,3-thiazole-4-carbonyl)piperidin-4-yl]butanamide |
| SMILES | CN(C(=O)[C@@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(C)(C)C)C1CCN(C(=O)c2csc(-c3ccncc3)n2)CC1 |
| InChI | InChI=1S/C31H44N6O5S/c1-31(2,3)26(34-27(39)23(18-37(42)20-38)17-21-7-5-6-8-21)30(41)35(4)24-11-15-36(16-12-24)29(40)25-19-43-28(33-25)22-9-13-32-14-10-22/h9-10,13-14,19-21,23-24,26,42H,5-8,11-12,15-18H2,1-4H3,(H,34,39)/t23-,26-/m1/s1 |
| InChIKey | FEOFPHQHVZWAHJ-ZEQKJWHPSA-N |
| XLogP | 3.84 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|