C31H45N7O5S — CID 58628972
(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)piperidin-4-yl]butanamide (PubChem CID 58628972) has the molecular formula C31H45N7O5S and a molecular weight of 627.81 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 58628972 |
| Molecular Formula | C31H45N7O5S |
| Molecular Weight | 627.81 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl)piperidin-4-yl]butanamide |
| SMILES | Cc1nc(-c2cnccn2)sc1C(=O)N1CCC(N(C)C(=O)[C@@H](NC(=O)[C@H](CC2CCCC2)CN(O)C=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C31H45N7O5S/c1-20-25(44-28(34-20)24-17-32-12-13-33-24)29(41)37-14-10-23(11-15-37)36(5)30(42)26(31(2,3)4)35-27(40)22(18-38(43)19-39)16-21-8-6-7-9-21/h12-13,17,19,21-23,26,43H,6-11,14-16,18H2,1-5H3,(H,35,40)/t22-,26-/m1/s1 |
| InChIKey | GHFCGNUHJQZVEL-ATIYNZHBSA-N |
| XLogP | 3.55 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|