C22H40N4O4 — CID 76843012
2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-piperidin-4-ylbutanamide (PubChem CID 76843012) has the molecular formula C22H40N4O4 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-piperidin-4-ylbutanamide.
| Compound Name | 2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 76843012 |
| Molecular Formula | C22H40N4O4 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-piperidin-4-ylbutanamide |
| SMILES | CN(C(=O)C(NC(=O)C(CC1CCCC1)CN(O)C=O)C(C)(C)C)C1CCNCC1 |
| InChI | InChI=1S/C22H40N4O4/c1-22(2,3)19(21(29)25(4)18-9-11-23-12-10-18)24-20(28)17(14-26(30)15-27)13-16-7-5-6-8-16/h15-19,23,30H,5-14H2,1-4H3,(H,24,28) |
| InChIKey | FHIKAKXTLLYHHM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|