C23H39N5O5 — CID 52933515
(2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)butan-2-yl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 52933515) has the molecular formula C23H39N5O5 and a molecular weight of 465.60 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)butan-2-yl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)butan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 52933515 |
| Molecular Formula | C23H39N5O5 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)butan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCC2(CC1)NCNC2=O |
| InChI | InChI=1S/C23H39N5O5/c1-22(2,3)18(20(31)27-10-8-23(9-11-27)21(32)24-14-25-23)26-19(30)17(13-28(33)15-29)12-16-6-4-5-7-16/h15-18,25,33H,4-14H2,1-3H3,(H,24,32)(H,26,30)/t17-,18-/m1/s1 |
| InChIKey | VQORAOZXPSVIOL-QZTJIDSGSA-N |
| XLogP | 0.60 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|