C31H48N4O5 — CID 74220829
(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide (PubChem CID 74220829) has the molecular formula C31H48N4O5 and a molecular weight of 556.75 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide |
|---|---|
| PubChem CID | 74220829 |
| Molecular Formula | C31H48N4O5 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide |
| SMILES | COc1ccc2c(c1)CN(C1CCN(C(=O)[C@@H](NC(=O)[C@H](CC3CCCC3)CN(O)C=O)C(C)(C)C)CC1)CC2 |
| InChI | InChI=1S/C31H48N4O5/c1-31(2,3)28(32-29(37)25(20-35(39)21-36)17-22-7-5-6-8-22)30(38)33-15-12-26(13-16-33)34-14-11-23-9-10-27(40-4)18-24(23)19-34/h9-10,18,21-22,25-26,28,39H,5-8,11-17,19-20H2,1-4H3,(H,32,37)/t25-,28-/m1/s1 |
| InChIKey | KLKQYSXQUBNUQX-LEAFIULHSA-N |
| XLogP | 3.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|