C30H47N5O5 — CID 91173682
(2S)-N-[(2R)-1-[4-[(4-acetamidophenyl)methylamino]piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide (PubChem CID 91173682) has the molecular formula C30H47N5O5 and a molecular weight of 557.74 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-[4-[(4-acetamidophenyl)methylamino]piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2S)-N-[(2R)-1-[4-[(4-acetamidophenyl)methylamino]piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 91173682 |
| Molecular Formula | C30H47N5O5 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.36 |
| IUPAC Name | (2S)-N-[(2R)-1-[4-[(4-acetamidophenyl)methylamino]piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(=O)Nc1ccc(CNC2CCN(C(=O)[C@H](NC(=O)[C@@H](CC3CCCC3)CN(O)C=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C30H47N5O5/c1-21(37)32-26-11-9-23(10-12-26)18-31-25-13-15-34(16-14-25)29(39)27(30(2,3)4)33-28(38)24(19-35(40)20-36)17-22-7-5-6-8-22/h9-12,20,22,24-25,27,31,40H,5-8,13-19H2,1-4H3,(H,32,37)(H,33,38)/t24-,27-/m0/s1 |
| InChIKey | QASTZYCNABWIFR-IGKIAQTJSA-N |
| XLogP | 3.30 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|