C28H41FN4O5 — CID 72567596
N-[1-[2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]-4-fluorobenzamide (PubChem CID 72567596) has the molecular formula C28H41FN4O5 and a molecular weight of 532.66 g/mol. Its IUPAC name is N-[1-[2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 72567596 |
| Molecular Formula | C28H41FN4O5 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | N-[1-[2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]-4-fluorobenzamide |
| SMILES | CC(C)(C)C(NC(=O)C(CC1CCCC1)CN(O)C=O)C(=O)N1CCC(NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H41FN4O5/c1-28(2,3)24(31-26(36)21(17-33(38)18-34)16-19-6-4-5-7-19)27(37)32-14-12-23(13-15-32)30-25(35)20-8-10-22(29)11-9-20/h8-11,18-19,21,23-24,38H,4-7,12-17H2,1-3H3,(H,30,35)(H,31,36) |
| InChIKey | GPXYUBYZAFKOCI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|