C28H39N5O5 — CID 59808828
4-cyano-N-[1-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3-methylbutanoyl]piperidin-4-yl]benzamide (PubChem CID 59808828) has the molecular formula C28H39N5O5 and a molecular weight of 525.65 g/mol. Its IUPAC name is 4-cyano-N-[1-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3-methylbutanoyl]piperidin-4-yl]benzamide.
| Compound Name | 4-cyano-N-[1-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3-methylbutanoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 59808828 |
| Molecular Formula | C28H39N5O5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 4-cyano-N-[1-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3-methylbutanoyl]piperidin-4-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCC(NC(=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C28H39N5O5/c1-19(2)25(31-27(36)23(17-33(38)18-34)15-20-5-3-4-6-20)28(37)32-13-11-24(12-14-32)30-26(35)22-9-7-21(16-29)8-10-22/h7-10,18-20,23-25,38H,3-6,11-15,17H2,1-2H3,(H,30,35)(H,31,36)/t23-,25+/m1/s1 |
| InChIKey | KEEVFMZOAQGFLV-NOZRDPDXSA-N |
| XLogP | 2.46 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|