C28H41N5O4 — CID 78320574
(2R)-N-[(2S)-1-[(3S)-3-[(4-cyanophenyl)methylamino]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide (PubChem CID 78320574) has the molecular formula C28H41N5O4 and a molecular weight of 511.67 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(3S)-3-[(4-cyanophenyl)methylamino]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-N-[(2S)-1-[(3S)-3-[(4-cyanophenyl)methylamino]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 78320574 |
| Molecular Formula | C28H41N5O4 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | (2R)-N-[(2S)-1-[(3S)-3-[(4-cyanophenyl)methylamino]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CC[C@H](NCc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C28H41N5O4/c1-28(2,3)25(31-26(35)23(17-33(37)19-34)14-20-6-4-5-7-20)27(36)32-13-12-24(18-32)30-16-22-10-8-21(15-29)9-11-22/h8-11,19-20,23-25,30,37H,4-7,12-14,16-18H2,1-3H3,(H,31,35)/t23-,24+,25-/m1/s1 |
| InChIKey | MYGCGDXWIMLNBI-DSNGMDLFSA-N |
| XLogP | 2.82 |
| TPSA | 125.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|