C29H44N4O6 — CID 58893016
benzyl 4-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]-1,4-diazepane-1-carboxylate (PubChem CID 58893016) has the molecular formula C29H44N4O6 and a molecular weight of 544.69 g/mol. Its IUPAC name is benzyl 4-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | benzyl 4-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 58893016 |
| Molecular Formula | C29H44N4O6 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | benzyl 4-[(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-3,3-dimethylbutanoyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H44N4O6/c1-29(2,3)25(30-26(35)24(19-33(38)21-34)18-22-10-7-8-11-22)27(36)31-14-9-15-32(17-16-31)28(37)39-20-23-12-5-4-6-13-23/h4-6,12-13,21-22,24-25,38H,7-11,14-20H2,1-3H3,(H,30,35)/t24-,25-/m1/s1 |
| InChIKey | HDIXYJSEDZOWGG-JWQCQUIFSA-N |
| XLogP | 3.43 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|