C29H44N4O5 — CID 11962306
(2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-[(2-phenylacetyl)amino]piperidin-1-yl]butan-2-yl]-N'-hydroxybutanediamide (PubChem CID 11962306) has the molecular formula C29H44N4O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-[(2-phenylacetyl)amino]piperidin-1-yl]butan-2-yl]-N'-hydroxybutanediamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-[(2-phenylacetyl)amino]piperidin-1-yl]butan-2-yl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 11962306 |
| Molecular Formula | C29H44N4O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-3,3-dimethyl-1-oxo-1-[4-[(2-phenylacetyl)amino]piperidin-1-yl]butan-2-yl]-N'-hydroxybutanediamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@@H](CC(=O)NO)CC1CCCC1)C(=O)N1CCC(NC(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H44N4O5/c1-29(2,3)26(31-27(36)22(19-25(35)32-38)17-20-11-7-8-12-20)28(37)33-15-13-23(14-16-33)30-24(34)18-21-9-5-4-6-10-21/h4-6,9-10,20,22-23,26,38H,7-8,11-19H2,1-3H3,(H,30,34)(H,31,36)(H,32,35)/t22-,26-/m1/s1 |
| InChIKey | OFQCSKPNQUQUFK-ATIYNZHBSA-N |
| XLogP | 2.96 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|