C26H40N4O5 — CID 11962301
(2R)-N-[(2S)-1-(4-benzamidopiperidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide (PubChem CID 11962301) has the molecular formula C26H40N4O5 and a molecular weight of 488.63 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-(4-benzamidopiperidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide.
| Compound Name | (2R)-N-[(2S)-1-(4-benzamidopiperidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 11962301 |
| Molecular Formula | C26H40N4O5 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (2R)-N-[(2S)-1-(4-benzamidopiperidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@H](C(=O)N1CCC(NC(=O)c2ccccc2)CC1)C(C)(C)C |
| InChI | InChI=1S/C26H40N4O5/c1-17(2)15-19(16-21(31)29-35)24(33)28-22(26(3,4)5)25(34)30-13-11-20(12-14-30)27-23(32)18-9-7-6-8-10-18/h6-10,17,19-20,22,35H,11-16H2,1-5H3,(H,27,32)(H,28,33)(H,29,31)/t19-,22-/m1/s1 |
| InChIKey | XAQNPZRMNLXESF-DENIHFKCSA-N |
| XLogP | 2.50 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|