C17H25N3OS — CID 3218527
N-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]benzamide (PubChem CID 3218527) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]benzamide.
| Compound Name | N-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 3218527 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[1-(2-methylpropylcarbamothioyl)piperidin-4-yl]benzamide |
| SMILES | CC(C)CNC(=S)N1CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3OS/c1-13(2)12-18-17(22)20-10-8-15(9-11-20)19-16(21)14-6-4-3-5-7-14/h3-7,13,15H,8-12H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | RIEJTLKWRAQTKH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|