C30H45N5O4 — CID 127044590
(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(1H-indol-5-ylmethylamino)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide (PubChem CID 127044590) has the molecular formula C30H45N5O4 and a molecular weight of 539.72 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(1H-indol-5-ylmethylamino)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(1H-indol-5-ylmethylamino)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide |
|---|---|
| PubChem CID | 127044590 |
| Molecular Formula | C30H45N5O4 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S)-1-[4-(1H-indol-5-ylmethylamino)piperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCC(NCc2ccc3[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C30H45N5O4/c1-30(2,3)27(33-28(37)24(19-35(39)20-36)16-21-6-4-5-7-21)29(38)34-14-11-25(12-15-34)32-18-22-8-9-26-23(17-22)10-13-31-26/h8-10,13,17,20-21,24-25,27,31-32,39H,4-7,11-12,14-16,18-19H2,1-3H3,(H,33,37)/t24-,27-/m1/s1 |
| InChIKey | PDRRYOOAVIWTOJ-SHQCIBLASA-N |
| XLogP | 3.82 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|