C32H47N7O5 — CID 58628952
(2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(5-methyl-2-phenyltriazole-4-carbonyl)piperidin-4-yl]butanamide (PubChem CID 58628952) has the molecular formula C32H47N7O5 and a molecular weight of 609.77 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(5-methyl-2-phenyltriazole-4-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(5-methyl-2-phenyltriazole-4-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 58628952 |
| Molecular Formula | C32H47N7O5 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | (2S)-2-[[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N,3,3-trimethyl-N-[1-(5-methyl-2-phenyltriazole-4-carbonyl)piperidin-4-yl]butanamide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)N1CCC(N(C)C(=O)[C@@H](NC(=O)[C@H](CC2CCCC2)CN(O)C=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C32H47N7O5/c1-22-27(35-39(34-22)26-13-7-6-8-14-26)30(42)37-17-15-25(16-18-37)36(5)31(43)28(32(2,3)4)33-29(41)24(20-38(44)21-40)19-23-11-9-10-12-23/h6-8,13-14,21,23-25,28,44H,9-12,15-20H2,1-5H3,(H,33,41)/t24-,28-/m1/s1 |
| InChIKey | XCTJCCCISDTKAQ-UFHPHHKVSA-N |
| XLogP | 3.21 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|