C34H54N4O6 — CID 89376892
4-[1-[(2S)-2-[[(2R)-2-[[butoxy(formyl)amino]methyl]-3-cyclopentylpropanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N,N-dimethylbenzamide (PubChem CID 89376892) has the molecular formula C34H54N4O6 and a molecular weight of 614.83 g/mol. Its IUPAC name is 4-[1-[(2S)-2-[[(2R)-2-[[butoxy(formyl)amino]methyl]-3-cyclopentylpropanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N,N-dimethylbenzamide.
| Compound Name | 4-[1-[(2S)-2-[[(2R)-2-[[butoxy(formyl)amino]methyl]-3-cyclopentylpropanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 89376892 |
| Molecular Formula | C34H54N4O6 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | 4-[1-[(2S)-2-[[(2R)-2-[[butoxy(formyl)amino]methyl]-3-cyclopentylpropanoyl]amino]-3,3-dimethylbutanoyl]piperidin-4-yl]oxy-N,N-dimethylbenzamide |
| SMILES | CCCCON(C=O)C[C@@H](CC1CCCC1)C(=O)N[C@H](C(=O)N1CCC(Oc2ccc(C(=O)N(C)C)cc2)CC1)C(C)(C)C |
| InChI | InChI=1S/C34H54N4O6/c1-7-8-21-43-38(24-39)23-27(22-25-11-9-10-12-25)31(40)35-30(34(2,3)4)33(42)37-19-17-29(18-20-37)44-28-15-13-26(14-16-28)32(41)36(5)6/h13-16,24-25,27,29-30H,7-12,17-23H2,1-6H3,(H,35,40)/t27-,30-/m1/s1 |
| InChIKey | SJGDQWWEEWUDOK-POURPWNDSA-N |
| XLogP | 4.68 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|